C15H21ClF4N2 — CID 171167050
1-[(1S)-3-methyl-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine;hydrochloride (PubChem CID 171167050) has the molecular formula C15H21ClF4N2 and a molecular weight of 340.79 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-3-methyl-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167050 |
| Molecular Formula | C15H21ClF4N2 |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[(1S)-3-methyl-1-(2,3,5,6-tetrafluorophenyl)butyl]piperazine;hydrochloride |
| SMILES | CC(C)C[C@@H](c1c(F)c(F)cc(F)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H20F4N2.ClH/c1-9(2)7-12(21-5-3-20-4-6-21)13-14(18)10(16)8-11(17)15(13)19;/h8-9,12,20H,3-7H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | HEZQISXVGMEWCR-YDALLXLXSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|