C14H20N2O3 — CID 171284666
2-[(1S)-1-piperazin-1-ylbut-3-enyl]benzene-1,3,5-triol (PubChem CID 171284666) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[(1S)-1-piperazin-1-ylbut-3-enyl]benzene-1,3,5-triol.
| Compound Name | 2-[(1S)-1-piperazin-1-ylbut-3-enyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 171284666 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[(1S)-1-piperazin-1-ylbut-3-enyl]benzene-1,3,5-triol |
| SMILES | C=CC[C@@H](c1c(O)cc(O)cc1O)N1CCNCC1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-3-11(16-6-4-15-5-7-16)14-12(18)8-10(17)9-13(14)19/h2,8-9,11,15,17-19H,1,3-7H2/t11-/m0/s1 |
| InChIKey | XYKMMAZACAIFIF-NSHDSACASA-N |
| XLogP | 1.33 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|