C19H30N2 — CID 171282356
1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)but-3-enyl]piperazine (PubChem CID 171282356) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)but-3-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)but-3-enyl]piperazine |
|---|---|
| PubChem CID | 171282356 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)but-3-enyl]piperazine |
| SMILES | C=CC[C@@H](c1c(C)c(C)c(C)c(C)c1C)N1CCNCC1 |
| InChI | InChI=1S/C19H30N2/c1-7-8-18(21-11-9-20-10-12-21)19-16(5)14(3)13(2)15(4)17(19)6/h7,18,20H,1,8-12H2,2-6H3/t18-/m0/s1 |
| InChIKey | AFMZROYWQPYBOL-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|