C15H25Cl2FN2O — CID 171307332
2-fluoro-6-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride (PubChem CID 171307332) has the molecular formula C15H25Cl2FN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-fluoro-6-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride.
| Compound Name | 2-fluoro-6-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307332 |
| Molecular Formula | C15H25Cl2FN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-fluoro-6-[(1R)-1-piperazin-1-ylpentyl]phenol;dihydrochloride |
| SMILES | CCCC[C@H](c1cccc(F)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H23FN2O.2ClH/c1-2-3-7-14(18-10-8-17-9-11-18)12-5-4-6-13(16)15(12)19;;/h4-6,14,17,19H,2-3,7-11H2,1H3;2*1H/t14-;;/m1../s1 |
| InChIKey | ZOXBBJBOULDRTJ-FMOMHUKBSA-N |
| XLogP | 3.51 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|