C23H34Cl2N2O2 — CID 171311256
2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]-5-phenylmethoxyphenol;dihydrochloride (PubChem CID 171311256) has the molecular formula C23H34Cl2N2O2 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]-5-phenylmethoxyphenol;dihydrochloride.
| Compound Name | 2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]-5-phenylmethoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 171311256 |
| Molecular Formula | C23H34Cl2N2O2 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[(1R)-4-methyl-1-piperazin-1-ylpentyl]-5-phenylmethoxyphenol;dihydrochloride |
| SMILES | CC(C)CC[C@H](c1ccc(OCc2ccccc2)cc1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C23H32N2O2.2ClH/c1-18(2)8-11-22(25-14-12-24-13-15-25)21-10-9-20(16-23(21)26)27-17-19-6-4-3-5-7-19;;/h3-7,9-10,16,18,22,24,26H,8,11-15,17H2,1-2H3;2*1H/t22-;;/m1../s1 |
| InChIKey | CXOUNKPWNLPJAJ-GJICFQLNSA-N |
| XLogP | 5.20 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|