C17H25F3N2 — CID 171169001
1-[(1R)-1-(4-tert-butylphenyl)-3,3,3-trifluoropropyl]piperazine (PubChem CID 171169001) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-[(1R)-1-(4-tert-butylphenyl)-3,3,3-trifluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-tert-butylphenyl)-3,3,3-trifluoropropyl]piperazine |
|---|---|
| PubChem CID | 171169001 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[(1R)-1-(4-tert-butylphenyl)-3,3,3-trifluoropropyl]piperazine |
| SMILES | CC(C)(C)c1ccc([C@@H](CC(F)(F)F)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H25F3N2/c1-16(2,3)14-6-4-13(5-7-14)15(12-17(18,19)20)22-10-8-21-9-11-22/h4-7,15,21H,8-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | DPGWTQKWXJZDBF-OAHLLOKOSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |