C15H23FN2 — CID 171164269
1-[(1S)-1-(2,6-dimethylphenyl)-3-fluoropropyl]piperazine (PubChem CID 171164269) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-[(1S)-1-(2,6-dimethylphenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,6-dimethylphenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171164269 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-[(1S)-1-(2,6-dimethylphenyl)-3-fluoropropyl]piperazine |
| SMILES | Cc1cccc(C)c1[C@H](CCF)N1CCNCC1 |
| InChI | InChI=1S/C15H23FN2/c1-12-4-3-5-13(2)15(12)14(6-7-16)18-10-8-17-9-11-18/h3-5,14,17H,6-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | XMDSGDKNRXASLF-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |