C14H20ClFN2 — CID 171166861
1-[(1S)-1-(2-chloro-6-methylphenyl)-3-fluoropropyl]piperazine (PubChem CID 171166861) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chloro-6-methylphenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1S)-1-(2-chloro-6-methylphenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171166861 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[(1S)-1-(2-chloro-6-methylphenyl)-3-fluoropropyl]piperazine |
| SMILES | Cc1cccc(Cl)c1[C@H](CCF)N1CCNCC1 |
| InChI | InChI=1S/C14H20ClFN2/c1-11-3-2-4-12(15)14(11)13(5-6-16)18-9-7-17-8-10-18/h2-4,13,17H,5-10H2,1H3/t13-/m0/s1 |
| InChIKey | CYSWIYXAHAVMIR-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |