C15H11NO7 — CID 58003779
1-O-methyl 3-O-(4-nitrophenyl) 5-hydroxybenzene-1,3-dicarboxylate (PubChem CID 58003779) has the molecular formula C15H11NO7 and a molecular weight of 317.25 g/mol. Its IUPAC name is 1-O-methyl 3-O-(4-nitrophenyl) 5-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-(4-nitrophenyl) 5-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58003779 |
| Molecular Formula | C15H11NO7 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-O-methyl 3-O-(4-nitrophenyl) 5-hydroxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(O)cc(C(=O)Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H11NO7/c1-22-14(18)9-6-10(8-12(17)7-9)15(19)23-13-4-2-11(3-5-13)16(20)21/h2-8,17H,1H3 |
| InChIKey | XLHXYEZQCHBYQR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|