About (4-acetylphenyl) 2-chloro-5-nitrobenzoate
(4-acetylphenyl) 2-chloro-5-nitrobenzoate (PubChem CID 775373) has the molecular formula C15H10ClNO5
and a molecular weight of 319.70 g/mol. Its IUPAC name is (4-acetylphenyl) 2-chloro-5-nitrobenzoate.
Molecular Properties
| Compound Name | (4-acetylphenyl) 2-chloro-5-nitrobenzoate |
| PubChem CID | 775373 |
| Molecular Formula | C15H10ClNO5 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (4-acetylphenyl) 2-chloro-5-nitrobenzoate |
| SMILES | CC(=O)c1ccc(OC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C15H10ClNO5/c1-9(18)10-2-5-12(6-3-10)22-15(19)13-8-11(17(20)21)4-7-14(13)16/h2-8H,1H3 |
| InChIKey | LKNDRIVPQKWFRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetylphenyl) 2-chloro-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) 2-chloro-5-nitrobenzoate?
The IUPAC name of (4-acetylphenyl) 2-chloro-5-nitrobenzoate (CID 775373) is (4-acetylphenyl) 2-chloro-5-nitrobenzoate.
What is the SMILES notation for (4-acetylphenyl) 2-chloro-5-nitrobenzoate?
The canonical SMILES for (4-acetylphenyl) 2-chloro-5-nitrobenzoate is CC(=O)c1ccc(OC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1.
What is the InChIKey of (4-acetylphenyl) 2-chloro-5-nitrobenzoate?
The InChIKey is LKNDRIVPQKWFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO5/c1-9(18)10-2-5-12(6-3-10)22-15(19)13-8-11(17(20)21)4-7-14(13)16/h2-8H,1H3.
What are the key properties of (4-acetylphenyl) 2-chloro-5-nitrobenzoate?
(4-acetylphenyl) 2-chloro-5-nitrobenzoate has a molecular weight of 319.70 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) 2-chloro-5-nitrobenzoate is sourced from PubChem (CID 775373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).