C22H27ClN4O4 — CID 3449553
N-butan-2-yl-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 3449553) has the molecular formula C22H27ClN4O4 and a molecular weight of 446.94 g/mol. Its IUPAC name is N-butan-2-yl-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-butan-2-yl-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3449553 |
| Molecular Formula | C22H27ClN4O4 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-butan-2-yl-2-chloro-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCC(C)N(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H27ClN4O4/c1-4-15(2)25(22(29)19-10-9-17(27(30)31)12-20(19)23)14-21(28)26(16-7-8-16)13-18-6-5-11-24(18)3/h5-6,9-12,15-16H,4,7-8,13-14H2,1-3H3 |
| InChIKey | LMDXZAUELGKYCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|