C22H29ClN4O4 — CID 42767742
4-chloro-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitro-N-propylbenzamide (PubChem CID 42767742) has the molecular formula C22H29ClN4O4 and a molecular weight of 448.95 g/mol. Its IUPAC name is 4-chloro-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitro-N-propylbenzamide.
| Compound Name | 4-chloro-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 42767742 |
| Molecular Formula | C22H29ClN4O4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-chloro-N-[2-[2-methylpropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-nitro-N-propylbenzamide |
| SMILES | CCCN(CC(=O)N(Cc1cccn1C)CC(C)C)C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H29ClN4O4/c1-5-10-25(22(29)17-8-9-19(23)20(12-17)27(30)31)15-21(28)26(13-16(2)3)14-18-7-6-11-24(18)4/h6-9,11-12,16H,5,10,13-15H2,1-4H3 |
| InChIKey | ZBMHJCKYKAFHAF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|