C21H27ClN4O5S — CID 3350743
2-[(4-chloro-3-nitrophenyl)sulfonyl-prop-2-enylamino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3350743) has the molecular formula C21H27ClN4O5S and a molecular weight of 482.99 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-prop-2-enylamino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-prop-2-enylamino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3350743 |
| Molecular Formula | C21H27ClN4O5S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-prop-2-enylamino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1cccn1C)CC(C)C)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27ClN4O5S/c1-5-10-25(32(30,31)18-8-9-19(22)20(12-18)26(28)29)15-21(27)24(13-16(2)3)14-17-7-6-11-23(17)4/h5-9,11-12,16H,1,10,13-15H2,2-4H3 |
| InChIKey | DQXQXOHFOWKOGA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 105.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|