C30H37ClN4O5S — CID 4263274
N-[(1-benzylpyrrol-2-yl)methyl]-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]-N-cyclohexylacetamide (PubChem CID 4263274) has the molecular formula C30H37ClN4O5S and a molecular weight of 601.17 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]-N-cyclohexylacetamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 4263274 |
| Molecular Formula | C30H37ClN4O5S |
| Molecular Weight | 601.17 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methylpropyl)amino]-N-cyclohexylacetamide |
| SMILES | CC(C)CN(CC(=O)N(Cc1cccn1Cc1ccccc1)C1CCCCC1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H37ClN4O5S/c1-23(2)19-33(41(39,40)27-15-16-28(31)29(18-27)35(37)38)22-30(36)34(25-12-7-4-8-13-25)21-26-14-9-17-32(26)20-24-10-5-3-6-11-24/h3,5-6,9-11,14-18,23,25H,4,7-8,12-13,19-22H2,1-2H3 |
| InChIKey | SEOCXIPHCPKZNE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 105.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.17 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|