C31H37FN4O4 — CID 3605647
N-butan-2-yl-N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 3605647) has the molecular formula C31H37FN4O4 and a molecular weight of 548.66 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-butan-2-yl-N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3605647 |
| Molecular Formula | C31H37FN4O4 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | N-butan-2-yl-N-[2-[cyclohexyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CCC(C)N(CC(=O)N(Cc1cccn1Cc1ccc(F)cc1)C1CCCCC1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H37FN4O4/c1-3-23(2)34(31(38)25-13-17-28(18-14-25)36(39)40)22-30(37)35(27-8-5-4-6-9-27)21-29-10-7-19-33(29)20-24-11-15-26(32)16-12-24/h7,10-19,23,27H,3-6,8-9,20-22H2,1-2H3 |
| InChIKey | VXSSGNSDBBPEER-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 88.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|