C22H22ClN3O4S — CID 3898917
4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 3898917) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 3898917 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4-chloro-N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-3-nitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(Cc1cccn1Cc1ccccc1C)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22ClN3O4S/c1-3-12-25(31(29,30)20-10-11-21(23)22(14-20)26(27)28)16-19-9-6-13-24(19)15-18-8-5-4-7-17(18)2/h3-11,13-14H,1,12,15-16H2,2H3 |
| InChIKey | CQUSXJKBPVSZHW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|