C22H22N2O4S — CID 55501447
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 55501447) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 55501447 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N(C1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H22N2O4S/c25-21(24(15-9-10-15)16-11-12-29(27,28)14-16)13-23-19-7-3-1-5-17(19)22(26)18-6-2-4-8-20(18)23/h1-8,15-16H,9-14H2 |
| InChIKey | SZICQGHOOQAYPP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|