C16H21ClN2O4S — CID 75426289
2-(2-chloro-6-oxo-1-pyridinyl)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 75426289) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is 2-(2-chloro-6-oxo-1-pyridinyl)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(2-chloro-6-oxo-1-pyridinyl)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 75426289 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(2-chloro-6-oxo-1-pyridinyl)-N-cyclopentyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(Cn1c(Cl)cccc1=O)N(C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21ClN2O4S/c17-14-6-3-7-15(20)18(14)10-16(21)19(12-4-1-2-5-12)13-8-9-24(22,23)11-13/h3,6-7,12-13H,1-2,4-5,8-11H2 |
| InChIKey | GCEGCVZGWPWGOI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|