C17H20N2O3S — CID 94171528
(2S)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 94171528) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is (2S)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94171528 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2S)-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCC[C@H]2c2cccs2)cc1O |
| InChI | InChI=1S/C17H20N2O3S/c1-22-15-7-6-12(10-14(15)20)11-18-17(21)19-8-2-4-13(19)16-5-3-9-23-16/h3,5-7,9-10,13,20H,2,4,8,11H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | WDHCKTSLNRJIFW-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |