C17H21N3O2S — CID 51959608
(2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 51959608) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51959608 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2S)-N-[(2-ethoxy-3-pyridinyl)methyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | CCOc1ncccc1CNC(=O)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C17H21N3O2S/c1-2-22-16-13(6-3-9-18-16)12-19-17(21)20-10-4-7-14(20)15-8-5-11-23-15/h3,5-6,8-9,11,14H,2,4,7,10,12H2,1H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | SPFVZMNPTSLKIL-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |