C27H35Cl2N3O2S — CID 45481172
N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-3-yl]propyl]thiophene-2-carboxamide (PubChem CID 45481172) has the molecular formula C27H35Cl2N3O2S and a molecular weight of 536.57 g/mol. Its IUPAC name is N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-3-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-3-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45481172 |
| Molecular Formula | C27H35Cl2N3O2S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[3-[1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]piperidin-3-yl]propyl]thiophene-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CCCNC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C27H35Cl2N3O2S/c28-23-12-10-21(19-24(23)29)11-13-26(33)30-14-2-1-3-16-32-17-5-8-22(20-32)7-4-15-31-27(34)25-9-6-18-35-25/h6,9-13,18-19,22H,1-5,7-8,14-17,20H2,(H,30,33)(H,31,34)/b13-11+ |
| InChIKey | RYECAVBLJLROOW-ACCUITESSA-N |
| XLogP | 6.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|