C30H37Cl2N3O4 — CID 44533719
N-[3-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-3-yl]propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 44533719) has the molecular formula C30H37Cl2N3O4 and a molecular weight of 574.55 g/mol. Its IUPAC name is N-[3-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-3-yl]propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 44533719 |
| Molecular Formula | C30H37Cl2N3O4 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | N-[3-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CCCNC(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C30H37Cl2N3O4/c31-25-11-8-22(18-26(25)32)9-13-29(36)33-14-2-1-3-16-35-17-5-7-23(20-35)6-4-15-34-30(37)24-10-12-27-28(19-24)39-21-38-27/h8-13,18-19,23H,1-7,14-17,20-21H2,(H,33,36)(H,34,37) |
| InChIKey | JBRADNIHEDHWFN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|