C27H44N4O3 — CID 42751352
5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42751352) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42751352 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C27H44N4O3/c1-4-6-7-22(5-2)26(32)29-23-8-9-25(31-13-10-21(3)11-14-31)24(20-23)27(33)28-12-15-30-16-18-34-19-17-30/h8-9,20-22H,4-7,10-19H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | KKGVFPYNUUNAAK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|