C31H35F3N4O2 — CID 42751508
2-(4-benzylpiperidin-1-yl)-N-(2-methylpropyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 42751508) has the molecular formula C31H35F3N4O2 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(2-methylpropyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(2-methylpropyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42751508 |
| Molecular Formula | C31H35F3N4O2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(2-methylpropyl)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H35F3N4O2/c1-21(2)20-35-29(39)27-19-26(37-30(40)36-25-10-6-9-24(18-25)31(32,33)34)11-12-28(27)38-15-13-23(14-16-38)17-22-7-4-3-5-8-22/h3-12,18-19,21,23H,13-17,20H2,1-2H3,(H,35,39)(H2,36,37,40) |
| InChIKey | GLTOCOGBXLMGQT-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|