C33H43N3O3 — CID 4304484
N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]adamantane-1-carboxamide (PubChem CID 4304484) has the molecular formula C33H43N3O3 and a molecular weight of 529.73 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4304484 |
| Molecular Formula | C33H43N3O3 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-methoxyethylcarbamoyl)phenyl]adamantane-1-carboxamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)C23CC4CC(CC(C4)C2)C3)ccc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C33H43N3O3/c1-39-14-11-34-31(37)29-19-28(35-32(38)33-20-25-16-26(21-33)18-27(17-25)22-33)7-8-30(29)36-12-9-24(10-13-36)15-23-5-3-2-4-6-23/h2-8,19,24-27H,9-18,20-22H2,1H3,(H,34,37)(H,35,38) |
| InChIKey | XOFVIHQQSVJVHS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|