C28H41N3O3 — CID 5189813
N-[3-(3-methoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]adamantane-1-carboxamide (PubChem CID 5189813) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is N-[3-(3-methoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(3-methoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 5189813 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | N-[3-(3-methoxypropylcarbamoyl)-4-(4-methylpiperidin-1-yl)phenyl]adamantane-1-carboxamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)C23CC4CC(CC(C4)C2)C3)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C28H41N3O3/c1-19-6-9-31(10-7-19)25-5-4-23(15-24(25)26(32)29-8-3-11-34-2)30-27(33)28-16-20-12-21(17-28)14-22(13-20)18-28/h4-5,15,19-22H,3,6-14,16-18H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | IVTYDCSJUILDRD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|