C19H30N4O6S — CID 50766198
5-(ethylsulfonylamino)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid (PubChem CID 50766198) has the molecular formula C19H30N4O6S and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-(ethylsulfonylamino)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 5-(ethylsulfonylamino)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766198 |
| Molecular Formula | C19H30N4O6S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-(ethylsulfonylamino)-2-[4-[2-(3-methoxypropylamino)-2-oxoethyl]piperazin-1-yl]benzoic acid |
| SMILES | CCS(=O)(=O)Nc1ccc(N2CCN(CC(=O)NCCCOC)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H30N4O6S/c1-3-30(27,28)21-15-5-6-17(16(13-15)19(25)26)23-10-8-22(9-11-23)14-18(24)20-7-4-12-29-2/h5-6,13,21H,3-4,7-12,14H2,1-2H3,(H,20,24)(H,25,26) |
| InChIKey | HWROOYDUJABEFQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|