C24H23F2N3O4S — CID 50766373
2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-5-[(3-fluorophenyl)sulfonylamino]benzoic acid (PubChem CID 50766373) has the molecular formula C24H23F2N3O4S and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-5-[(3-fluorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-5-[(3-fluorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766373 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-5-[(3-fluorophenyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cccc(F)c2)ccc1N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23F2N3O4S/c25-18-5-3-6-20(14-18)34(32,33)27-19-8-9-23(21(15-19)24(30)31)29-12-10-28(11-13-29)16-17-4-1-2-7-22(17)26/h1-9,14-15,27H,10-13,16H2,(H,30,31) |
| InChIKey | XEVLTQFQJMFRGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|