C21H24N4O — CID 78896555
2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 78896555) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 78896555 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCCN(c3ccccc3C#N)CC2)c1 |
| InChI | InChI=1S/C21H24N4O/c1-17-6-4-8-19(14-17)23-21(26)16-24-10-5-11-25(13-12-24)20-9-3-2-7-18(20)15-22/h2-4,6-9,14H,5,10-13,16H2,1H3,(H,23,26) |
| InChIKey | YZIRPYPGZBESPR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |