C22H24N4O3 — CID 60511148
methyl 4-[[2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]acetyl]amino]benzoate (PubChem CID 60511148) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is methyl 4-[[2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 60511148 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | methyl 4-[[2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2CCCN(c3ccccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-29-22(28)17-7-9-19(10-8-17)24-21(27)16-25-11-4-12-26(14-13-25)20-6-3-2-5-18(20)15-23/h2-3,5-10H,4,11-14,16H2,1H3,(H,24,27) |
| InChIKey | ZURNOOBGWAIFDT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |