C20H20Cl2N4O — CID 60511172
2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(2,6-dichlorophenyl)acetamide (PubChem CID 60511172) has the molecular formula C20H20Cl2N4O and a molecular weight of 403.31 g/mol. Its IUPAC name is 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60511172 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[4-(2-cyanophenyl)-1,4-diazepan-1-yl]-N-(2,6-dichlorophenyl)acetamide |
| SMILES | N#Cc1ccccc1N1CCCN(CC(=O)Nc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C20H20Cl2N4O/c21-16-6-3-7-17(22)20(16)24-19(27)14-25-9-4-10-26(12-11-25)18-8-2-1-5-15(18)13-23/h1-3,5-8H,4,9-12,14H2,(H,24,27) |
| InChIKey | ANJRCOUBWKKCLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |