C16H13F3N2O5S — CID 24591397
4-[[4-acetamido-2-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 24591397) has the molecular formula C16H13F3N2O5S and a molecular weight of 402.35 g/mol. Its IUPAC name is 4-[[4-acetamido-2-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-acetamido-2-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 24591397 |
| Molecular Formula | C16H13F3N2O5S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-[[4-acetamido-2-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | CC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C(=O)O)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O5S/c1-9(22)20-11-4-7-14(13(8-11)16(17,18)19)21-27(25,26)12-5-2-10(3-6-12)15(23)24/h2-8,21H,1H3,(H,20,22)(H,23,24) |
| InChIKey | ANGOOJJRPVWQLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |