C19H21F3N2O5S — CID 24604753
N-[4-[(3,4-diethoxyphenyl)sulfonylamino]-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 24604753) has the molecular formula C19H21F3N2O5S and a molecular weight of 446.45 g/mol. Its IUPAC name is N-[4-[(3,4-diethoxyphenyl)sulfonylamino]-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-[(3,4-diethoxyphenyl)sulfonylamino]-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24604753 |
| Molecular Formula | C19H21F3N2O5S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[4-[(3,4-diethoxyphenyl)sulfonylamino]-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(NC(C)=O)cc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C19H21F3N2O5S/c1-4-28-17-9-7-14(11-18(17)29-5-2)30(26,27)24-16-8-6-13(23-12(3)25)10-15(16)19(20,21)22/h6-11,24H,4-5H2,1-3H3,(H,23,25) |
| InChIKey | IJHINTRMOVYWAW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |