C19H18ClF3N2O4 — CID 108519957
N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-diethoxyphenyl)oxamide (PubChem CID 108519957) has the molecular formula C19H18ClF3N2O4 and a molecular weight of 430.81 g/mol. Its IUPAC name is N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-diethoxyphenyl)oxamide.
| Compound Name | N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-diethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108519957 |
| Molecular Formula | C19H18ClF3N2O4 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-diethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)Nc2ccc(Cl)cc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C19H18ClF3N2O4/c1-3-28-15-8-6-12(10-16(15)29-4-2)24-17(26)18(27)25-14-7-5-11(20)9-13(14)19(21,22)23/h5-10H,3-4H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XCKXHVWVJDCHPS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|