C19H14BrFN2O3S — CID 164615573
4-bromo-2-fluoro-N-[4-(phenylsulfamoyl)phenyl]benzamide (PubChem CID 164615573) has the molecular formula C19H14BrFN2O3S and a molecular weight of 449.30 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-[4-(phenylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-bromo-2-fluoro-N-[4-(phenylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 164615573 |
| Molecular Formula | C19H14BrFN2O3S |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 4-bromo-2-fluoro-N-[4-(phenylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C19H14BrFN2O3S/c20-13-6-11-17(18(21)12-13)19(24)22-14-7-9-16(10-8-14)27(25,26)23-15-4-2-1-3-5-15/h1-12,23H,(H,22,24) |
| InChIKey | KRDXCENPLJYGST-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |