C10H10F3NO3S2 — CID 163591914
2-sulfanyl-N-[3-(trifluoromethylsulfonyl)phenyl]propanamide (PubChem CID 163591914) has the molecular formula C10H10F3NO3S2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-sulfanyl-N-[3-(trifluoromethylsulfonyl)phenyl]propanamide.
| Compound Name | 2-sulfanyl-N-[3-(trifluoromethylsulfonyl)phenyl]propanamide |
|---|---|
| PubChem CID | 163591914 |
| Molecular Formula | C10H10F3NO3S2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-sulfanyl-N-[3-(trifluoromethylsulfonyl)phenyl]propanamide |
| SMILES | CC(S)C(=O)Nc1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3NO3S2/c1-6(18)9(15)14-7-3-2-4-8(5-7)19(16,17)10(11,12)13/h2-6,18H,1H3,(H,14,15) |
| InChIKey | GQFAKMLJRZYDQP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|