C13H15F3N2O3S — CID 163395292
2-amino-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 163395292) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-amino-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 2-amino-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 163395292 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-amino-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCCC1C(=O)Nc1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)22(20,21)9-4-1-3-8(7-9)18-12(19)10-5-2-6-11(10)17/h1,3-4,7,10-11H,2,5-6,17H2,(H,18,19) |
| InChIKey | QLIUWIIDMIFKFP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |