C13H14F4N2O3S — CID 172782579
2-amino-1-fluoro-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 172782579) has the molecular formula C13H14F4N2O3S and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-amino-1-fluoro-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 2-amino-1-fluoro-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 172782579 |
| Molecular Formula | C13H14F4N2O3S |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-amino-1-fluoro-N-[3-(trifluoromethylsulfonyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCCC1(F)C(=O)Nc1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N2O3S/c14-12(6-2-5-10(12)18)11(20)19-8-3-1-4-9(7-8)23(21,22)13(15,16)17/h1,3-4,7,10H,2,5-6,18H2,(H,19,20) |
| InChIKey | OLNZTNVPEGQUBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |