C23H18FN3O2S — CID 18913097
4-fluoro-N-[3-[2-(1H-indol-6-ylamino)-2-oxoethyl]sulfanylphenyl]benzamide (PubChem CID 18913097) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-(1H-indol-6-ylamino)-2-oxoethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[2-(1H-indol-6-ylamino)-2-oxoethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18913097 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-fluoro-N-[3-[2-(1H-indol-6-ylamino)-2-oxoethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc(F)cc2)c1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C23H18FN3O2S/c24-17-7-4-16(5-8-17)23(29)27-18-2-1-3-20(12-18)30-14-22(28)26-19-9-6-15-10-11-25-21(15)13-19/h1-13,25H,14H2,(H,26,28)(H,27,29) |
| InChIKey | VQZDMWWGKUXPON-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |