C15H11FN2OS — CID 19318372
N-[3-(cyanomethylsulfanyl)phenyl]-4-fluorobenzamide (PubChem CID 19318372) has the molecular formula C15H11FN2OS and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[3-(cyanomethylsulfanyl)phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-(cyanomethylsulfanyl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 19318372 |
| Molecular Formula | C15H11FN2OS |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-[3-(cyanomethylsulfanyl)phenyl]-4-fluorobenzamide |
| SMILES | N#CCSc1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H11FN2OS/c16-12-6-4-11(5-7-12)15(19)18-13-2-1-3-14(10-13)20-9-8-17/h1-7,10H,9H2,(H,18,19) |
| InChIKey | ZUQLVMMPVTZRSJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |