C24H20ClFN2O2S — CID 18901803
N-(3-chloro-4-fluorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 18901803) has the molecular formula C24H20ClFN2O2S and a molecular weight of 454.95 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 18901803 |
| Molecular Formula | C24H20ClFN2O2S |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1cccc(NC(=O)/C=C/c2ccccc2)c1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClFN2O2S/c1-16(24(30)28-19-11-12-22(26)21(25)15-19)31-20-9-5-8-18(14-20)27-23(29)13-10-17-6-3-2-4-7-17/h2-16H,1H3,(H,27,29)(H,28,30)/b13-10+ |
| InChIKey | BVZWCVWLTGRQCY-JLHYYAGUSA-N |
| XLogP | 6.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|