C36H37ClN4O5S — CID 19308652
N-[(E)-3-[3-[1-(5-chloro-2,4-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308652) has the molecular formula C36H37ClN4O5S and a molecular weight of 673.24 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(5-chloro-2,4-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(5-chloro-2,4-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308652 |
| Molecular Formula | C36H37ClN4O5S |
| Molecular Weight | 673.24 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | N-[(E)-3-[3-[1-(5-chloro-2,4-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C36H37ClN4O5S/c1-6-33(36(44)39-29-21-28(37)31(45-4)22-32(29)46-5)47-27-14-10-13-25(20-27)38-35(43)30(40-34(42)24-11-8-7-9-12-24)19-23-15-17-26(18-16-23)41(2)3/h7-22,33H,6H2,1-5H3,(H,38,43)(H,39,44)(H,40,42)/b30-19+ |
| InChIKey | RKKXACDWWGQYLM-NDZAJKAJSA-N |
| XLogP | 7.34 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.24 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|