C40H36ClN3O6S — CID 19310164
N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19310164) has the molecular formula C40H36ClN3O6S and a molecular weight of 722.26 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310164 |
| Molecular Formula | C40H36ClN3O6S |
| Molecular Weight | 722.26 g/mol |
| Exact Mass | 721.20 |
| IUPAC Name | N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-ethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cc(Cl)c(OC)cc3OC)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C40H36ClN3O6S/c1-4-50-30-20-18-26(19-21-30)22-34(44-38(45)28-14-9-6-10-15-28)39(46)42-29-16-11-17-31(23-29)51-37(27-12-7-5-8-13-27)40(47)43-33-24-32(41)35(48-2)25-36(33)49-3/h5-25,37H,4H2,1-3H3,(H,42,46)(H,43,47)(H,44,45)/b34-22+ |
| InChIKey | AGSVRTHQVQJYDM-PPOKSSTKSA-N |
| XLogP | 8.64 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.26 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|