C45H39N3O6S — CID 19314776
N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314776) has the molecular formula C45H39N3O6S and a molecular weight of 749.89 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314776 |
| Molecular Formula | C45H39N3O6S |
| Molecular Weight | 749.89 g/mol |
| Exact Mass | 749.26 |
| IUPAC Name | N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccc(OCc4ccccc4)cc3)NC(=O)c3ccccc3)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C45H39N3O6S/c1-52-37-25-26-41(53-2)39(29-37)47-45(51)42(33-15-8-4-9-16-33)55-38-20-12-19-35(28-38)46-44(50)40(48-43(49)34-17-10-5-11-18-34)27-31-21-23-36(24-22-31)54-30-32-13-6-3-7-14-32/h3-29,42H,30H2,1-2H3,(H,46,50)(H,47,51)(H,48,49)/b40-27+ |
| InChIKey | XZCDGCJDPBTPFJ-WOQJSSNBSA-N |
| XLogP | 9.16 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.89 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|