C17H16ClNO2S — CID 112778861
N-[4-[2-(2-chlorophenyl)sulfanylpropanoyl]phenyl]acetamide (PubChem CID 112778861) has the molecular formula C17H16ClNO2S and a molecular weight of 333.84 g/mol. Its IUPAC name is N-[4-[2-(2-chlorophenyl)sulfanylpropanoyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(2-chlorophenyl)sulfanylpropanoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 112778861 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[4-[2-(2-chlorophenyl)sulfanylpropanoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)C(C)Sc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO2S/c1-11(22-16-6-4-3-5-15(16)18)17(21)13-7-9-14(10-8-13)19-12(2)20/h3-11H,1-2H3,(H,19,20) |
| InChIKey | AWCPAFVTPQBYLZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |