C22H26N6O2S — CID 26006165
N'-[(2R)-2-[[4-amino-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]benzohydrazide (PubChem CID 26006165) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N'-[(2R)-2-[[4-amino-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-[[4-amino-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 26006165 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N'-[(2R)-2-[[4-amino-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]benzohydrazide |
| SMILES | C[C@@H](Sc1nnc(-c2ccc(C(C)(C)C)cc2)n1N)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N6O2S/c1-14(19(29)25-26-20(30)16-8-6-5-7-9-16)31-21-27-24-18(28(21)23)15-10-12-17(13-11-15)22(2,3)4/h5-14H,23H2,1-4H3,(H,25,29)(H,26,30)/t14-/m1/s1 |
| InChIKey | LCOBZEGHSGVKRU-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|