C11H13N5OS — CID 42067106
3-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 42067106) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | 3-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42067106 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(-n2nnnc2SCCC(N)=O)cc1 |
| InChI | InChI=1S/C11H13N5OS/c1-8-2-4-9(5-3-8)16-11(13-14-15-16)18-7-6-10(12)17/h2-5H,6-7H2,1H3,(H2,12,17) |
| InChIKey | UZXRPATTZLDLNS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |