C14H13N5OS — CID 17445673
2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 17445673) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 17445673 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C14H13N5OS/c1-10-4-6-11(7-5-10)19-14(16-17-18-19)21-9-13(20)12-3-2-8-15-12/h2-8,15H,9H2,1H3 |
| InChIKey | VOFATBFVTUDGGT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |