C17H15F5N2O3S2 — CID 39951741
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide (PubChem CID 39951741) has the molecular formula C17H15F5N2O3S2 and a molecular weight of 454.44 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 39951741 |
| Molecular Formula | C17H15F5N2O3S2 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)CSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H15F5N2O3S2/c1-8-4-5-9(29(26,27)24(2)3)6-10(8)23-11(25)7-28-17-15(21)13(19)12(18)14(20)16(17)22/h4-6H,7H2,1-3H3,(H,23,25) |
| InChIKey | GDWLWOTWZHSFBL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|