C14H23N3O5S2 — CID 100784760
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[ethylsulfonyl(methyl)amino]acetamide (PubChem CID 100784760) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[ethylsulfonyl(methyl)amino]acetamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[ethylsulfonyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 100784760 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[ethylsulfonyl(methyl)amino]acetamide |
| SMILES | CCS(=O)(=O)N(C)CC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C14H23N3O5S2/c1-6-23(19,20)17(5)10-14(18)15-13-9-12(8-7-11(13)2)24(21,22)16(3)4/h7-9H,6,10H2,1-5H3,(H,15,18) |
| InChIKey | JNRCHHAZDJDTHP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |